| Company Name: |
Shijiazhuang Yesheng Chemical Technology Co., Ltd
|
| Tel: |
18031147013 |
| Email: |
yeshengchemical@163.com |
| Products Intro: |
Product Name:4-[[6-[(1-Oxo-2-propenyl)oxy]hexyl]oxy]benzoic acid 4-ethylphenyl ester
CAS:558467-39-3
Purity:95% Package:1g/
|
| Company Name: |
Hunan chemfish Scientific co.,ltd
|
| Tel: |
0731-85567275 15528049369 |
| Email: |
sales@chemfish.com |
| Products Intro: |
Product Name:4-[[6-[(1-Oxo-2-propenyl)oxy]hexyl]oxy]benzoic acid 4-ethylphenyl ester
CAS:558467-39-3
Purity:99% Package:25g 100g 1kg 10kg
|
| Company Name: |
Shanghai Daken Advanced Materials Co.,Ltd
|
| Tel: |
13938465051 |
| Email: |
info@dakenchem.com |
| Products Intro: |
Product Name:4-[[6-[(1-Oxo-2-propenyl)oxy]hexyl]oxy]benzoic acid 4-ethylphenyl ester
CAS:558467-39-3
Purity:95% HPLC Package:1KG ,5KG ,25KG
|
|
| | 4-[[6-[(1-Oxo-2-propenyl)oxy]hexyl]oxy]benzoic acid 4-ethylphenyl ester Basic information |
| | 4-[[6-[(1-Oxo-2-propenyl)oxy]hexyl]oxy]benzoic acid 4-ethylphenyl ester Chemical Properties |
| Boiling point | 533.8±45.0 °C(Predicted) | | density | 1.100±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C24H28O5/c1-3-19-9-13-22(14-10-19)29-24(26)20-11-15-21(16-12-20)27-17-7-5-6-8-18-28-23(25)4-2/h4,9-16H,2-3,5-8,17-18H2,1H3 | | InChIKey | ZBUSNVSMNNRMRQ-UHFFFAOYSA-N | | SMILES | C(OC1=CC=C(CC)C=C1)(=O)C1=CC=C(OCCCCCCOC(=O)C=C)C=C1 |
| | 4-[[6-[(1-Oxo-2-propenyl)oxy]hexyl]oxy]benzoic acid 4-ethylphenyl ester Usage And Synthesis |
| | 4-[[6-[(1-Oxo-2-propenyl)oxy]hexyl]oxy]benzoic acid 4-ethylphenyl ester Preparation Products And Raw materials |
|