| Company Name: |
Neostar United (Changzhou) Industrial Co., Ltd.
|
| Tel: |
0519-85556579 13376258932 |
| Email: |
project@neostarunited.com |
| Products Intro: |
Product Name:2-[(Isopropylideneamino)oxy]-ethanol
CAS:83495-51-6
Purity:208%，HPLC Package:噸，500kg，100kg，5kg，110kg
|
|
| | isopropylideneaMinooxyethanol Basic information |
| | isopropylideneaMinooxyethanol Chemical Properties |
| Boiling point | 54 °C(Press: 2-4 Torr) | | density | 0.9981 g/cm3(Temp: 25 °C) | | pka | 14.39±0.10(Predicted) | | InChI | InChI=1S/C5H11NO2/c1-5(2)6-8-4-3-7/h7H,3-4H2,1-2H3 | | InChIKey | SJTCPULGRKWPDM-UHFFFAOYSA-N | | SMILES | C/C(=N\OCCO)/C |
| | isopropylideneaMinooxyethanol Usage And Synthesis |
| Uses | Used as an intermediate in organic synthesis. |
| | isopropylideneaMinooxyethanol Preparation Products And Raw materials |
|