- 3-(Chloromethyl)heptane
-
- $380.00 / 190kg
-
2025-07-31
- CAS:123-04-6
- Min. Order: 1000kg
- Purity: 99.3%
- Supply Ability: 20 tons
- 3-(Chloromethyl)heptane
-
- $0.00 / 25KG
-
2025-07-07
- CAS:123-04-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 50000KG/month
|
| | 3-(Chloromethyl)heptane Basic information |
| Product Name: | 3-(Chloromethyl)heptane | | Synonyms: | TIMTEC-BB SBB005809;3-(chloromethyl)-heptan;3-chloromethyl-heptan;Chloro-iso-octane;Heptane, 3-(chloromethyl)-;hexane,1-chloro-2-ethyl-;1-CHLORO-2-ETHYLHEXANE;3-(CHLOROMETHYL)HEPTANE | | CAS: | 123-04-6 | | MF: | C8H17Cl | | MW: | 148.67 | | EINECS: | 204-594-4 | | Product Categories: | | | Mol File: | 123-04-6.mol |  |
| | 3-(Chloromethyl)heptane Chemical Properties |
| Melting point | -70 °C | | Boiling point | 166-168 °C | | density | 0.882 | | vapor pressure | 1.5hPa at 20℃ | | refractive index | 1.432-1.436 | | Fp | 60 °C | | storage temp. | Sealed in dry,Room Temperature | | form | Liquid | | color | Clear yellow | | Water Solubility | 0.0503 g/L (20 ºC) | | InChI | InChI=1S/C8H17Cl/c1-3-5-6-8(4-2)7-9/h8H,3-7H2,1-2H3 | | InChIKey | WLVCBAMXYMWGLJ-UHFFFAOYSA-N | | SMILES | CCC(CCl)CCCC | | LogP | 5.6 at 23℃ | | CAS DataBase Reference | 123-04-6(CAS DataBase Reference) | | NIST Chemistry Reference | 3-Chloromethyl heptane(123-04-6) | | EPA Substance Registry System | Heptane, 3-(chloromethyl)- (123-04-6) |
| | 3-(Chloromethyl)heptane Usage And Synthesis |
| Chemical Properties | Colorless liquid.Insoluble in water.
Combustible. | | Uses | Barchlor(R) 8I is used as chemical intermediate. | | Hazard | Moderate fire risk. | | Flammability and Explosibility | Flammable |
| | 3-(Chloromethyl)heptane Preparation Products And Raw materials |
|