|
|
| | 3,6,9-TRIOXAUNDECANEDIOIC ACID Basic information |
| Product Name: | 3,6,9-TRIOXAUNDECANEDIOIC ACID | | Synonyms: | O,O'-OXYDIETHYLENE-DIGLYCOLIC ACID;3,6,9-TRIOXAUNDECANEDIOIC ACID;TUDS;trioxaundecanedoicacid;2,2'-[oxybis(2,1-ethanediyloxy)]bisacetic acid;3,6,9-Trioxaundecanedioic acid (TUDS);Acetic acid, 2,2-oxybis(2,1-ethanediyloxy)bis-;2,2′-(Oxybis(2,1-ethandiyloxy))bisessigsure | | CAS: | 13887-98-4 | | MF: | C8H14O7 | | MW: | 222.19 | | EINECS: | 237-655-9 | | Product Categories: | Heterocyclic Compounds;peg | | Mol File: | 13887-98-4.mol |  |
| | 3,6,9-TRIOXAUNDECANEDIOIC ACID Chemical Properties |
| Boiling point | 443.7±30.0 °C(Predicted) | | density | 1.3 g/mL at 20 °C(lit.) | | vapor pressure | 0Pa at 20℃ | | refractive index | n20/D 1.470(lit.) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Soluble in Water, DMSO, DCM, DMF | | form | Solid-Liquid Mixture | | pka | 3.09±0.10(Predicted) | | color | Off-white to yellow | | PH | 1.8 (100g/l, H2O) | | BRN | 1962084 | | InChI | InChI=1S/C8H14O7/c9-7(10)5-14-3-1-13-2-4-15-6-8(11)12/h1-6H2,(H,9,10)(H,11,12) | | InChIKey | HJZZQNLKBWJYPD-UHFFFAOYSA-N | | SMILES | O(CCOCC(O)=O)CCOCC(O)=O | | LogP | -2.56 at 25℃ |
| Hazard Codes | Xi | | Risk Statements | 41 | | Safety Statements | 26-39 | | RIDADR | 1760 | | WGK Germany | 1 | | HazardClass | 8 | | PackingGroup | III |
| | 3,6,9-TRIOXAUNDECANEDIOIC ACID Usage And Synthesis |
| Description | PEG3-(CH2CO2H)2 is a PEG linker containing two terminal carboxylic acid groups. The hydrophilic PEG spacer increases solubility in aqueous media. The terminal carboxylic acids can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. | | Uses | 369-Trioxaundecanedioic Acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. | | Flammability and Explosibility | Not classified | | reaction suitability | reaction type: Pegylations
reagent type: cross-linking reagent | | IC 50 | PEGs | | References | [1] An S, et al. Small-molecule PROTACs: An emerging and promising approach for the development of targeted therapy drugs. EBioMedicine. 2018 Oct;36:553-562 DOI:10.1016/j.ebiom.2018.09.005 |
| | 3,6,9-TRIOXAUNDECANEDIOIC ACID Preparation Products And Raw materials |
|