|
| 3-Methyl-2-phenylpyridine Basic information |
| 3-Methyl-2-phenylpyridine Chemical Properties |
Boiling point | 148°C (16 mmHg) | density | 1.065 | refractive index | 1.6010 to 1.6040 | Fp | 96°C | storage temp. | Inert atmosphere,Room Temperature | pka | 4.73±0.10(Predicted) | form | clear liquid | color | Colorless to Light yellow to Light orange | InChI | InChI=1S/C12H11N/c1-10-6-5-9-13-12(10)11-7-3-2-4-8-11/h2-9H,1H3 | InChIKey | BJATUPPYBZHEIO-UHFFFAOYSA-N | SMILES | C1(C2=CC=CC=C2)=NC=CC=C1C | CAS DataBase Reference | 10273-90-2(CAS DataBase Reference) | NIST Chemistry Reference | Pyridine, 3-methyl-2-phenyl-(10273-90-2) |
| 3-Methyl-2-phenylpyridine Usage And Synthesis |
Chemical Properties | CLEAR BROWN LIQUID |
| 3-Methyl-2-phenylpyridine Preparation Products And Raw materials |
|