|
|
| | 2-ACETYL-5-CHLOROTHIOPHENE Basic information |
| Product Name: | 2-ACETYL-5-CHLOROTHIOPHENE | | Synonyms: | 1-(5-chloro-2-thienyl)ethan-1-one;1-(5-Chloro-thiophen-2-yl)-ethanone;5-CHLORO-2-THIENYL METHYL KETONE;5-CHLORO-2-ACETYLTHIOPHENE;2-Acetyl-5-chlorothiophene ,99%;2-Acetyl-5-chlorothiophene,5-Chloro-2-thienyl methyl ketone;2-Acetyl-5-chlorothi;2-Acetyl-5-chlorothiophene 99% | | CAS: | 6310-09-4 | | MF: | C6H5ClOS | | MW: | 160.62 | | EINECS: | 228-630-3 | | Product Categories: | Heterocycle-oher series;Heterocycles | | Mol File: | 6310-09-4.mol |  |
| | 2-ACETYL-5-CHLOROTHIOPHENE Chemical Properties |
| Melting point | 46-49 °C (lit.) | | Boiling point | 117-118 °C/17 mmHg (lit.) | | density | 1.3240 (estimate) | | Fp | 227 °F | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | Crystals or Crystalline Powder | | color | White to light yellow | | Sensitive | Light Sensitive | | BRN | 113936 | | InChI | InChI=1S/C6H5ClOS/c1-4(8)5-2-3-6(7)9-5/h2-3H,1H3 | | InChIKey | HTZGPEHWQCRXGZ-UHFFFAOYSA-N | | SMILES | C(=O)(C1SC(Cl)=CC=1)C | | CAS DataBase Reference | 6310-09-4(CAS DataBase Reference) |
| Risk Statements | 20/21/22 | | Safety Statements | 24/25-36/37 | | RIDADR | UN2811 | | WGK Germany | 3 | | RTECS | OB1745000 | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29349990 |
| | 2-ACETYL-5-CHLOROTHIOPHENE Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Synthesis | Example 8: In a 100 mL four-necked flask equipped with a stirrer, a condenser, a thermometer, and a dropping funnel, 5.9 g of activated white clay (a product of Nacalai Tesque, Inc.) and 25.5 g (0.25 mol) of acetic anhydride were added sequentially. The temperature of the reaction system was maintained at 45 °C to 55 °C and 29.6 g (0.25 mol) of 2-chlorothiophene was slowly added dropwise over 1 h in this temperature range. After the dropwise addition was completed, the reaction was continued with stirring at 50 °C for 72 hours. Upon completion of the reaction, the activated white clay was removed by filtration to give a dark brown filtrate. Subsequently, unreacted 2-chlorothiophene, acetic anhydride and the by-product acetic acid were removed from the filtrate by distillation, resulting in 20.9 g (0.13 mol) of 2-acetyl-5-chlorothiophene. | | References | [1] Patent: EP1695972, 2006, A1. Location in patent: Page/Page column 7
[2] Journal of the American Chemical Society, 1947, vol. 69, p. 3093,3095
[3] Journal of Organic Chemistry, 1948, vol. 13, p. 729,732
[4] Org. Synth. Coll. Vol. IV, <1963> 980,
[5] Journal of the American Chemical Society, 1947, vol. 69, p. 1014 |
| | 2-ACETYL-5-CHLOROTHIOPHENE Preparation Products And Raw materials |
|