- DIDNTB
-
- $0.00 / 25KG
-
2025-07-07
- CAS:145551-16-2
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 50000KG/month
- DIDNTB
-
- $2.00 / 1kg
-
2019-07-06
- CAS:145551-16-2
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: ask
|
| Product Name: | DIDNTB | | Synonyms: | DIDNTB;5',5'-Dinitro-3',3'-diiodo-3,4,5,6-trtrabromophenol-sulfonephthalein;4,4'-(4,5,6,7-Tetrabromo-1,1-dioxido-3H-2,1-benzoxathiol-3-ylidene)bis[2-iodo-6-nitrophenol];5', 5"- dinotro-3', 3"- diiodo-3,4,5,6-tetrobromophenolsulfonephthalein;4,5,6,7-Tetrabromo-3,3-bis(4-hydroxy-3-iodo-5-nitrophenyl)-3H-benzo[c][1,2]oxathiole 1,1-dioxide;5',5''-dinitro-3',3''-diiodo-3,4,5,6;2-iodo-6-nitro-4-[4,5,6,7-tetrabromo-3-(4-hydroxy-3-iodo-5-nitrophenyl)-1,1-dioxo-2,1λ^{6}-benzoxathiol-3-yl]phenol;Phenol, 4,4'-(4,5,6,7-tetrabromo-1,1-dioxido-3H-2,1-benzoxathiol-3-ylidene)bis[2-iodo-6-nitro- (9CI) | | CAS: | 145551-16-2 | | MF: | C19H6Br4I2N2O9S | | MW: | 1011.75 | | EINECS: | | | Product Categories: | | | Mol File: | 145551-16-2.mol |  |
| | DIDNTB Chemical Properties |
| Boiling point | 735.4±60.0 °C(Predicted) | | density | 2.717±0.06 g/cm3(Predicted) | | pka | 2.72±0.50(Predicted) | | form | Solid | | color | Light yellow to yellow | | InChI | InChI=1S/C19H6Br4I2N2O9S/c20-12-11-18(15(23)14(22)13(12)21)37(34,35)36-19(11,5-1-7(24)16(28)9(3-5)26(30)31)6-2-8(25)17(29)10(4-6)27(32)33/h1-4,28-29H | | InChIKey | NMHYCKTXIQQVPE-UHFFFAOYSA-N | | SMILES | IC1C(=C(C([H])=C(C=1[H])C1(C2C([H])=C(C(=C(C=2[H])[N+](=O)[O-])O[H])I)C2C(=C(C(=C(C=2S(=O)(=O)O1)Br)Br)Br)Br)[N+](=O)[O-])O[H] |
| | DIDNTB Usage And Synthesis |
| Uses | DIDNTB is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| | DIDNTB Preparation Products And Raw materials |
|