|
|
| | 4-Aminotriphenylamine Basic information |
| Product Name: | 4-Aminotriphenylamine | | Synonyms: | N,N'-DIPHENYL-P-PHENYLENEDIAMINE;(4-aminophenyl)-di(phenyl)amine;1-N,1-N-di(phenyl)benzene-1,4-diamine;N1,N1-di(phenyl)benzene-1,4-diamine;N1,N1-diphenyl-1,4-benzenediamine;4-Aminotriphenylamine N;OC1045, N,N-DIPHENYL-P-PHENYLENEDIAMINE;4-N,4-N-diphenylbenzene-1,4-diamine | | CAS: | 2350-01-8 | | MF: | C18H16N2 | | MW: | 260.33 | | EINECS: | 810-939-5 | | Product Categories: | | | Mol File: | 2350-01-8.mol |  |
| | 4-Aminotriphenylamine Chemical Properties |
| Melting point | 144.0 to 148.0 °C | | Boiling point | 270°C/57mmHg(lit.) | | density | 1.168±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | powder to crystalline | | pka | 5.20±0.10(Predicted) | | color | White to Brown | | λmax | 295nm(CH3CN)(lit.) | | InChI | InChI=1S/C18H16N2/c19-15-11-13-18(14-12-15)20(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-14H,19H2 | | InChIKey | UXKQNCDDHDBAPD-UHFFFAOYSA-N | | SMILES | C1(N(C2=CC=CC=C2)C2=CC=CC=C2)=CC=C(N)C=C1 | | EPA Substance Registry System | 1,4-Benzenediamine, N,N-diphenyl- (2350-01-8) |
| | 4-Aminotriphenylamine Usage And Synthesis |
| | 4-Aminotriphenylamine Preparation Products And Raw materials |
|