|
|
| | 1-Octanoylbenzotriazole Basic information |
| Product Name: | 1-Octanoylbenzotriazole | | Synonyms: | N-octanoyl Benzotriazole;1-(1H-Benzotriazol-1-Yl)-1-Octanone;1-(1H-Benzo[d][1,2,3]triazol-1-yl)octan-1-one;1-Octanone, 1-(1H-benzotriazol-1-yl)-;1-(benzotriazol-1-yl)octan-1-one | | CAS: | 58068-80-7 | | MF: | C14H19N3O | | MW: | 245.32 | | EINECS: | | | Product Categories: | Orlistat | | Mol File: | 58068-80-7.mol |  |
| | 1-Octanoylbenzotriazole Chemical Properties |
| Boiling point | 379.3±25.0 °C(Predicted) | | density | 1.12±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Oil | | pka | -0.40±0.30(Predicted) | | color | Pale Yellow | | InChI | InChI=1S/C14H19N3O/c1-2-3-4-5-6-11-14(18)17-13-10-8-7-9-12(13)15-16-17/h7-10H,2-6,11H2,1H3 | | InChIKey | QIYQQEDMCSJOAC-UHFFFAOYSA-N | | SMILES | C(N1C2=CC=CC=C2N=N1)(=O)CCCCCCC |
| | 1-Octanoylbenzotriazole Usage And Synthesis |
| Uses | 1-(1H-Benzotriazol-1-yl)-1-octanone is a useful intermediate, which is used in several types of reactions such as the prearation of N-acylpiperidines via acylation. | | Synthesis | To a solution of 0.024 g TCT (0.130 mmol) in 2 cm3CH2Cl2 was added 0.033 g triethylamine (0.325 mmol) at0 C and the resulting mixture was stirred for 5 min.Carboxylic acid (0.271 mmol) was then added with continuouslystirring for 10 min. Subsequently, to this mixturewas added 0.032 g 1H-benzotriazole (0.271 mmol) and thesolution was allowed to warm up to room temperature andstirred until completion of the reaction based on TLCanalysis. The crude reaction mixture was extracted withsaturated NaHCO3, then washed with 1 M HCl and water.The combined organic layer was dried over anhydroussodium sulfate and concentrated under reduced pressure to afford 1-Octanoylbenzotriazole. | | References | [1] European Journal of Organic Chemistry, 2014, vol. 2014, # 32, p. 7109 - 7112
[2] Monatshefte fur Chemie, 2015, vol. 146, # 6, p. 959 - 963 |
| | 1-Octanoylbenzotriazole Preparation Products And Raw materials |
|