|
|
| | L-Ascorbic acid phosphate magnesium salt Basic information |
| Product Name: | L-Ascorbic acid phosphate magnesium salt | | Synonyms: | L-Ascorbic acid phos;VitaMin C
MagnesiuM ascorbyl phosphate;MagnesiuM ascorbyl phosphate MagnesiuM ascorbate phosphate,MagnesiuM ascorbyl phosphate MagnesiuMasc;Magnlsium-L-Ascorbate-α-phosphate;Ascorbyl magnesium phosphate;l-ascorbic acid phosphate magnesium salt;L-Ascorbic acid 2-phosphoric acid·3/2magnesium salt;L-Ascorbicacidphosphatemagnesiumsal | | CAS: | 108910-78-7 | | MF: | C6H8O6.x(H3PO4).xMg | | MW: | 278.39 | | EINECS: | 281-602-2 | | Product Categories: | Cosmetics;Food or chemical grade | | Mol File: | 108910-78-7.mol |  |
| | L-Ascorbic acid phosphate magnesium salt Chemical Properties |
| InChI | InChI=1/C6H8O6.3Mg.2H3O4P/c7-1-2(8)5-3(9)4(10)6(11)12-5;;;;2*1-5(2,3)4/h2,5,7-10H,1H2;;;;2*(H3,1,2,3,4)/q;3*+2;;/p-6/t2-,5+;;;;;/s3 | | InChIKey | HTJNEBVCZXHBNJ-UOBQWJSINA-H | | SMILES | [Mg+2].[Mg+2].[Mg+2].P([O-])([O-])([O-])=O.P([O-])([O-])([O-])=O.OC1=C(O)C(=O)O[C@@H]1[C@H](CO)O |&1:20,21,r| |
| | L-Ascorbic acid phosphate magnesium salt Usage And Synthesis |
| Uses | L-Ascorbic acid phosphate magnesium salt is available as a cosmetic formulation such as creams, lotions and powders. It is readily absorbed into the skin and is rapidly converted by the body's phosphatase enzyme into vitamin C. It inhibits the production of melanin, which causes sunburn, blemishes and freckles, and also inhibits the formation of melanin, which causes sunburn, blemishes and freckles. l-Ascorbic acid phosphate magnesium salt results in smoother skin and fewer wrinkles. |
| | L-Ascorbic acid phosphate magnesium salt Preparation Products And Raw materials |
|