|
|
| | Avibactam Impurity 39 Basic information |
| Product Name: | Avibactam Impurity 39 | | Synonyms: | Avibactam Impurity 39;2-Piperidinecarboxylic acid, 5-[(phenylmethoxy)amino]-, ethyl ester, (2R,5R)-;ethyl (2R,5R)-5-((benzyloxy)amino)piperidine-2-carboxylate oxalate;ethyl (2R,5R)-5-(benzyloxyamino)piperidine-2-carboxylate;(2R, 5R) -benzyloxyaminopiperidine-2-carboxylic acid ethyl sulfate salt;R,R-IM-1 | | CAS: | 2089462-91-7 | | MF: | C15H22N2O3 | | MW: | 278.35 | | EINECS: | | | Product Categories: | | | Mol File: | 2089462-91-7.mol |  |
| | Avibactam Impurity 39 Chemical Properties |
| Boiling point | 391.2±52.0 °C(Predicted) | | density | 1.13±0.1 g/cm3(Predicted) | | pka | 7.47±0.10(Predicted) | | InChI | InChI=1S/C15H22N2O3/c1-2-19-15(18)14-9-8-13(10-16-14)17-20-11-12-6-4-3-5-7-12/h3-7,13-14,16-17H,2,8-11H2,1H3/t13-,14-/m1/s1 | | InChIKey | HJFGESFJQKOOEY-ZIAGYGMSSA-N | | SMILES | N1C[C@H](NOCC2=CC=CC=C2)CC[C@@H]1C(OCC)=O |
| | Avibactam Impurity 39 Usage And Synthesis |
| | Avibactam Impurity 39 Preparation Products And Raw materials |
|