|
| 4-FLUORO-3-FORMYL-BENZOIC ACID Basic information |
| 4-FLUORO-3-FORMYL-BENZOIC ACID Chemical Properties |
Melting point | 152 °C | Boiling point | 332.3±27.0 °C(Predicted) | density | 1.426±0.06 g/cm3(Predicted) | storage temp. | 2-8°C, stored under nitrogen | pka | 3.79±0.10(Predicted) | Appearance | White to off-white Solid | InChI | InChI=1S/C8H5FO3/c9-7-2-1-5(8(11)12)3-6(7)4-10/h1-4H,(H,11,12) | InChIKey | SKPWEADPCJMLID-UHFFFAOYSA-N | SMILES | C(O)(=O)C1=CC=C(F)C(C=O)=C1 |
Hazard Codes | Xn | Risk Statements | 22 | HS Code | 2916399090 |
| 4-FLUORO-3-FORMYL-BENZOIC ACID Usage And Synthesis |
| 4-FLUORO-3-FORMYL-BENZOIC ACID Preparation Products And Raw materials |
|