|
| 4-(Trifluoromethyl)cyclohexanecarboxylic acid Basic information |
| 4-(Trifluoromethyl)cyclohexanecarboxylic acid Chemical Properties |
Melting point | 71-75 °C(lit.) | Boiling point | 230-231°C | density | 1.292±0.06 g/cm3(Predicted) | pka | 4.60±0.10(Predicted) | form | powder to crystal | color | White to Almost white | InChI | InChI=1S/C8H11F3O2/c9-8(10,11)6-3-1-5(2-4-6)7(12)13/h5-6H,1-4H2,(H,12,13) | InChIKey | LMEAZIIFLVDISW-UHFFFAOYSA-N | SMILES | C1(C(O)=O)CCC(C(F)(F)F)CC1 | CAS DataBase Reference | 95233-30-0(CAS DataBase Reference) |
| 4-(Trifluoromethyl)cyclohexanecarboxylic acid Usage And Synthesis |
| 4-(Trifluoromethyl)cyclohexanecarboxylic acid Preparation Products And Raw materials |
|