Perfluorononanoic acid manufacturers
- Perfluorononanoic acid
-
- $50.00 / 1KG
-
2023-12-23
- CAS:375-95-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
- Perfluorononanoic acid
-
- $10.00 / 1KG
-
2021-08-31
- CAS:375-95-1
- Min. Order: 1KG
- Purity: 99.99%
- Supply Ability: 20 tons/month
|
| | Perfluorononanoic acid Basic information |
| Product Name: | Perfluorononanoic acid | | Synonyms: | HEPTADECAFLUORO-N-NONANOIC ACID;HEPTADECAFLUOROPELARGONIC ACID;PERFLUORONONANOIC ACID;PERFLUORO-N-NONANOIC ACID;PERFLUOROPELARGONIC ACID;N-HEPTADECAFLUORONONANOIC ACID;2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-Heptadecafluorononanoic acid;heptadecafluoro-nonanoicaci | | CAS: | 375-95-1 | | MF: | C9HF17O2 | | MW: | 464.08 | | EINECS: | 206-801-3 | | Product Categories: | Fluorous Chemistry;Fluorous Compounds;Synthetic Organic Chemistry | | Mol File: | 375-95-1.mol |  |
| | Perfluorononanoic acid Chemical Properties |
| Melting point | 59-62 °C (lit.) | | Boiling point | 218°C | | density | 1.7397 (estimate) | | Fp | 218°C | | storage temp. | Refrigerator | | solubility | Acetone (Slightly), DMSO (Slightly), Methanol (Slightly) | | pka | 0.52±0.10(Predicted) | | form | Solid | | color | Off-White to Beige | | BRN | 1897287 | | Stability: | Stable. Incompatible with strong bases, strong oxidizing agents. Corrosive - causes burns. | | InChI | InChI=1S/C9HF17O2/c10-2(11,1(27)28)3(12,13)4(14,15)5(16,17)6(18,19)7(20,21)8(22,23)9(24,25)26/h(H,27,28) | | InChIKey | UZUFPBIDKMEQEQ-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F | | CAS DataBase Reference | 375-95-1(CAS DataBase Reference) | | EPA Substance Registry System | Perfluorononanoic acid (375-95-1) |
| | Perfluorononanoic acid Usage And Synthesis |
| Chemical Properties | Perfluorononanoic acid is a white crystalline powder or beige crystals. Perfluorononanoic acid has the ability to react with bases, oxidizing agents, and reducing agents. Upon decomposition, PFNA can form carbon oxides and hydrogen fluoride. | | Uses | Perfluorinated compounds (PFCs) are persistent in environments due to the high energy of C-F bond
routes. PFNA may interfere in a toxic fashion on the immune system, liver, development, and endocrine systems. | | Uses | Perfluorinated compounds (PFCs) are persistent in environments due to the high energy of C-F bond. Being a persistent environmental pollutant, it can accumulate in human tissues via various exposure routes. PFNA may interfere in a toxic fashion on the immune system, liver, development, and endocrine systems. | | Definition | ChEBI: Perfluorononanoic acid is a fluoroalkanoic acid that is nonanoic acid in which all of the hydrogens in the alkyl chain are replaced by fluorines. It has a role as a persistent organic pollutant, a xenobiotic and a surfactant. It is functionally related to a nonanoic acid. |
| | Perfluorononanoic acid Preparation Products And Raw materials |
|