Stearic acid-N-hydroxysuccinimide ester manufacturers
|
| Stearic acid-N-hydroxysuccinimide ester Basic information |
| Stearic acid-N-hydroxysuccinimide ester Chemical Properties |
Melting point | 92-93°C | Boiling point | 473.1±28.0 °C(Predicted) | density | 1.01±0.1 g/cm3(Predicted) | storage temp. | 2-8°C | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | form | Solid | color | White to Off-White | InChI | InChI=1S/C22H39NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22(26)27-23-20(24)18-19-21(23)25/h2-19H2,1H3 | InChIKey | ZERWDZDNDJBYKA-UHFFFAOYSA-N | SMILES | C(ON1C(=O)CCC1=O)(=O)CCCCCCCCCCCCCCCCC | CAS DataBase Reference | 14464-32-5(CAS DataBase Reference) |
| Stearic acid-N-hydroxysuccinimide ester Usage And Synthesis |
Chemical Properties | Colourless Shiny Leaflets | Uses | N-Succinimidyl Stearate (cas# 14464-32-5) is a compound useful in organic synthesis. | Uses | A Nicotine metabolite. Carcinogen. | Uses | Stearic Acid derivative. | General Description | Stearic acid N-hydroxysuccinimide ester is an N-Hydroxysuccinimide ester of fatty acid. They are used in the synthesis of N-acyl amino acids and fatty acyl CoA. They are also used in the direct N-acylation of sphingenine or sphinganine thus leading to the formation of ceramides. |
| Stearic acid-N-hydroxysuccinimide ester Preparation Products And Raw materials |
|