| Identification | Back Directory | [Name]
BDP 558/568 carboxylic acid | [CAS]
150173-72-1 | [Synonyms]
BDP 558/568 COOH
BDP 558/568 carboxylic acid
BODIPY 558/568 carboxylic acid | [Molecular Formula]
C16H13BF2N2O2S | [MDL Number]
MFCD31580088 | [MOL File]
150173-72-1.mol | [Molecular Weight]
346.16 |
| Chemical Properties | Back Directory | [solubility ]
Soluble in DCM, DMF, DMSO | [Appearance]
Dark brown flake solid | [ex/em]
561/569 nm | [ε(extinction coefficient)]
84400 L?mol?1?cm?1 | [Φ(quantum yield)]
0.68 | [InChI]
InChI=1S/C16H13BF2N2O2S/c18-17(19)20-11(6-8-16(22)23)3-4-12(20)10-13-5-7-14(21(13)17)15-2-1-9-24-15/h1-5,7,9-10H,6,8H2,(H,22,23) | [InChIKey]
ZVTFVFIEVANQLT-UHFFFAOYSA-N | [SMILES]
[F-][B+3]1([N-]2C(=CC=C2C=C2C=CC(C3SC=CC=3)=N12)CCC(=O)[O-])[F-].[H+] |
| Hazard Information | Back Directory | [Description]
BDP 558/568 carboxylic acid is a BDP linker containing a carboxylic acid. The BDP 558/568 has similar excitation and emission wavelengths to Cy3. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. | [Uses]
BDP 558/568 carboxylic acid is a BDP linker containing a carboxylic acid. The BDP 558/568 has similar excitation and emission wavelengths to Cy3. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. |
|
| Company Name: |
Alfa Chemistry
|
| Tel: |
1-516-6625404 |
| Website: |
https://www.alfa-chemistry.com |
|