|
|
| | 6-(4-Cyano-biphenyl-4'-yloxy)hexyl acrylate Basic information |
| Product Name: | 6-(4-Cyano-biphenyl-4'-yloxy)hexyl acrylate | | Synonyms: | 6-(4-Cyano-biphenyl-4'-yloxy)hexyl acrylate;4'-(6-(acryloyloxy)hexyloxy) -4-biphenyl carbonitrile;6-(4'-Cyanobiphenyl-4-oxy)hexyl acrylate;4-(6-Acryloyloxyhexyloxy)-4'-cyano-1,1'-biphenyl;4-[(6-Acryloyloxy)hexyloxy]-4'-cyanobiphenyl;6-((4'-cyano-[1,1'-biphenyl]-4-yl)oxy)hexyl acrylate;2-Propenoic acid, 6-[(4'-cyano[1,1'-biphenyl]-4-yl)oxy]hexyl ester;Acrylic Acid 6-[(4'-Cyano-[1,1'-biphenyl]-4-yl)oxy]hexyl Ester | | CAS: | 89823-23-4 | | MF: | C22H23NO3 | | MW: | 349.42 | | EINECS: | | | Product Categories: | | | Mol File: | 89823-23-4.mol |  |
| | 6-(4-Cyano-biphenyl-4'-yloxy)hexyl acrylate Chemical Properties |
| Melting point | 71°C(lit.) | | Boiling point | 518.4±45.0 °C(Predicted) | | density | 1.12±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | solubility | soluble in Acetone | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C22H23NO3/c1-2-22(24)26-16-6-4-3-5-15-25-21-13-11-20(12-14-21)19-9-7-18(17-23)8-10-19/h2,7-14H,1,3-6,15-16H2 | | InChIKey | IGHSOWSFSFGPAZ-UHFFFAOYSA-N | | SMILES | C(OCCCCCCOC1=CC=C(C2=CC=C(C#N)C=C2)C=C1)(=O)C=C |
| | 6-(4-Cyano-biphenyl-4'-yloxy)hexyl acrylate Usage And Synthesis |
| Chemical Properties | white to almost white powder to crystal |
| | 6-(4-Cyano-biphenyl-4'-yloxy)hexyl acrylate Preparation Products And Raw materials |
|