|
|
| | 4-(dimethylammonio)piperidinium dichloride Basic information |
| Product Name: | 4-(dimethylammonio)piperidinium dichloride | | Synonyms: | 4-DIMETHYLAMINOPIPERIDINE 2HCL;4-(Dimethylamino)piperidine dihydrochloride,98%;Dimethyl-piperidin-4-yl-amine dihydrochloride;N,N-dimethylpiperidin-4-amine dihydrochloride;Dimethyl-piperidin-4-yl-amine dihydorochloride;DiMethyl-piperidin-4-yl-aMine di, HCl;4-(diMethylaMino)-piperidine dihydorochloride;4-(dimethylammonio)piperidinium dichloride | | CAS: | 4876-59-9 | | MF: | C7H18Cl2N2 | | MW: | 201.13722 | | EINECS: | 225-486-3 | | Product Categories: | | | Mol File: | 4876-59-9.mol |  |
| | 4-(dimethylammonio)piperidinium dichloride Chemical Properties |
| Melting point | 288-290℃ | | storage temp. | Inert atmosphere,Room Temperature | | Appearance | White to yellow Solid | | InChI | InChI=1S/C7H16N2.ClH/c1-9(2)7-3-5-8-6-4-7;/h7-8H,3-6H2,1-2H3;1H | | InChIKey | IDCJGSDAPFXTGB-UHFFFAOYSA-N | | SMILES | N(C1CCNCC1)(C)C.Cl |
| HazardClass | IRRITANT | | HS Code | 29333990 |
| | 4-(dimethylammonio)piperidinium dichloride Usage And Synthesis |
| Chemical Properties | White powder | | Uses | Dimethyl-piperidin-4-yl-amine DiHCl | | Synthesis | General procedure for the synthesis of 4-dimethylaminopiperidine dihydrochloride from N-Boc-4-dimethylaminopiperidine: 10.0 g of tert-butyl 4-(dimethylamino)piperidine-1-carboxylate (0.044 mol) was dissolved in 60 mL of dichloromethane and cooled in an ice bath. Subsequently, 4 mol/L of HCl/dioxane solution (34.5 mL, 0.138 mol) was slowly added, and stirring was maintained during the dropwise addition. The reaction mixture was continued to be stirred under ice bath conditions for 8 hours. Upon completion of the reaction, a large amount of white solid precipitate was observed to be generated, and the precipitate was collected by filtration and washed with a small amount of cold dichloromethane to remove residual HCl. 6.4 g of the target product, 4-dimethylaminopiperidine dihydrochloride, was finally obtained in 85.3% yield. | | References | [1] Patent: CN108456183, 2018, A. Location in patent: Paragraph 0020; 0101-0103
[2] Synthetic Communications, 2009, vol. 39, # 2, p. 273 - 277 |
| | 4-(dimethylammonio)piperidinium dichloride Preparation Products And Raw materials |
|