|
| 4-Bromo-2-methylimidazole Basic information |
| 4-Bromo-2-methylimidazole Chemical Properties |
Melting point | 158-160°C | Boiling point | 333.9±15.0 °C(Predicted) | density | 1.723±0.06 g/cm3(Predicted) | storage temp. | Inert atmosphere,2-8°C | pka | 12.26±0.10(Predicted) | form | solid | color | White | InChI | InChI=1S/C4H5BrN2/c1-3-6-2-4(5)7-3/h2H,1H3,(H,6,7) | InChIKey | APLZLUYWLINBOZ-UHFFFAOYSA-N | SMILES | C1(C)NC(Br)=CN=1 | CAS DataBase Reference | 16265-11-5(CAS DataBase Reference) |
Hazard Codes | Xi | Risk Statements | 36/37/38 | Safety Statements | 26-36/37/39 | Hazard Note | Irritant/Keep Cold | HS Code | 2933299090 |
| 4-Bromo-2-methylimidazole Usage And Synthesis |
| 4-Bromo-2-methylimidazole Preparation Products And Raw materials |
|