1,4-Benzenedicarboxylic acid bis(4-aminophenyl) ester manufacturers
|
| | 1,4-Benzenedicarboxylic acid bis(4-aminophenyl) ester Basic information |
| Product Name: | 1,4-Benzenedicarboxylic acid bis(4-aminophenyl) ester | | Synonyms: | 1,4-Benzenedicarboxylic acid bis(4-aminophenyl) ester;Bis(4-aminophenyl) terephthalate;1,4-Benzenedicarboxylicacid, 1,4-bis(4-aMinophenyl) ester;bis(4-aminophenyl) benzene-1,4-dicarboxylate;BPTP;1,4-Benzenedicarboxylic acid bis(4-aminophenyl) ester(BAPT);Terephthalic Acid Bis(4-aminophenyl) Ester;Bis(4-aminophenyl)terephthalate (BAPT) | | CAS: | 16926-73-1 | | MF: | C20H16N2O4 | | MW: | 348.35 | | EINECS: | 1312995-182-4 | | Product Categories: | | | Mol File: | 16926-73-1.mol |  |
| | 1,4-Benzenedicarboxylic acid bis(4-aminophenyl) ester Chemical Properties |
| Melting point | 238 °C | | Boiling point | 608.6±50.0 °C(Predicted) | | density | 1.335 | | storage temp. | 2-8°C, protect from light | | pka | 4.07±0.10(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C20H16N2O4/c21-15-5-9-17(10-6-15)25-19(23)13-1-2-14(4-3-13)20(24)26-18-11-7-16(22)8-12-18/h1-12H,21-22H2 | | InChIKey | CFTXGNJIXHFHTH-UHFFFAOYSA-N | | SMILES | C1(C(OC2=CC=C(N)C=C2)=O)=CC=C(C(OC2=CC=C(N)C=C2)=O)C=C1 |
| | 1,4-Benzenedicarboxylic acid bis(4-aminophenyl) ester Usage And Synthesis |
| Uses | Bis(4-aminophenyl) Terephthalate is used in method for preparing low TG high frequency MPI compound and double-sided high frequency Copper clad laminate. |
| | 1,4-Benzenedicarboxylic acid bis(4-aminophenyl) ester Preparation Products And Raw materials |
|