Glycerol phenylbutyrate manufacturers
|
| | Glycerol phenylbutyrate Basic information |
| Product Name: | Glycerol phenylbutyrate | | Synonyms: | Glycerol phenylbutyrate;BENZENEBUTANOIC ACID, 1,2,3-PROPANETRIYL ESTER;Propane-1,2,3-triyl tris(4-phenylbutanoate);HPN-100;Benzenebutanoic acid, 1,1',1''-(1,2,3-propanetriyl) ester;2,3-bis(4-phenylbutanoyloxy)propyl4-phenylbutanoate;Glycerol phenylbutryate;Ravicti | | CAS: | 611168-24-2 | | MF: | C33H38O6 | | MW: | 530.65 | | EINECS: | | | Product Categories: | APIS | | Mol File: | 611168-24-2.mol |  |
| | Glycerol phenylbutyrate Chemical Properties |
| Boiling point | 621.2±45.0 °C(Predicted) | | density | 1.131±0.06 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMSO:150.0(Max Conc. mg/mL);282.67(Max Conc. mM)
Ethanol:50.0(Max Conc. mg/mL);94.22(Max Conc. mM) | | form | Oil | | color | Colourless | | InChIKey | ZSDBFLMJVAGKOU-UHFFFAOYSA-N | | SMILES | C(OC(=O)CCCC1=CC=CC=C1)C(OC(=O)CCCC1=CC=CC=C1)COC(=O)CCCC1=CC=CC=C1 |
| | Glycerol phenylbutyrate Usage And Synthesis |
| Uses | Tri(4-phenylbutyryl)glycerol is a drug that is currently under development for treatment of urea cyclic disorders (UCDs). It works by preventing the harmful buildup of ammonia in the body. | | Definition | ChEBI: Glycerol phenylbutyrate is a triglyceride. | | Biological Activity | Glycerol phenylbutyrate, a triacylglycerol, is a prodrug of ER stress inhibitor 4-phenylbutyric acid (PBA). Glycerol phenylbutyrate is a nitrogen-binding agent approved for the chronic management of adult and pediatric patients (≥2 years of age) with urea cycle disorders (UCDs) who cannot be managed by dietary protein restriction and/or amino acid supplementation alone. | | in vivo | Glycerol phenylbutyrate (GPB) has the potential for the treatment of hyperammonemia. Glycerol phenylbutyrate (GPB) may have therapeutic potential in additional conditions such as chronic hepatic encephalopathy or other inherited metabolic disorders[1][2]. | | IC 50 | Sigma 2 Receptor |
| | Glycerol phenylbutyrate Preparation Products And Raw materials |
|