- PCY3 Pd G2
-
- $0.00 / 100G
-
2024-12-17
- CAS:1353658-81-7
- Min. Order: 100G
- Purity: 98%
- Supply Ability: 5KG
|
| | Chloro[(tricyclohexylphosphine)-2-(2'-aminobiphenyl)]palladium(II) Basic information |
| Product Name: | Chloro[(tricyclohexylphosphine)-2-(2'-aminobiphenyl)]palladium(II) | | Synonyms: | Chloro[(tricyclohexylphosphine)-2-(2'-aminobiphenyl)]palladium(II);PCy3 Pd G2;Tricyclohexylphosphine Pd G2;(SP-4-3)-[2'-(Amino)[1,1'-biphenyl]-2-yl]chloro(tricyclohexylphosphine)palladium;(SP-4-3)-[2'-(Amino-κN)[1,1'-biphenyl]-2-yl-κC]chloro(tricyclohexylphosphine)palladium;PCy3 Palladacycle Gen.2;Chloro[(tricyclohexylphosphine)(2'-aminobiphenyl-2-yl)palladium(II);Chloro[(tricyclohexylphosphine)(2'-aminobiphenyl-2-yl)palladium(II) / PCy3 Pd G2 | | CAS: | 1353658-81-7 | | MF: | C30H42ClNPPd+2 | | MW: | 589.507941 | | EINECS: | | | Product Categories: | | | Mol File: | 1353658-81-7.mol | ![Chloro[(tricyclohexylphosphine)-2-(2'-aminobiphenyl)]palladium(II) Structure](CAS/20180703/GIF/1353658-81-7.gif) |
| | Chloro[(tricyclohexylphosphine)-2-(2'-aminobiphenyl)]palladium(II) Chemical Properties |
| Melting point | 244-246 °C | | storage temp. | 2-8°C, protect from light, stored under nitrogen | | form | solid | | InChIKey | YJEJUSIMNMMILB-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC=C2N)=CC=CC=C1[Pd+2].P(C1CCCCC1)(C1CCCCC1)C1(Cl)CCCCC1 |
| | Chloro[(tricyclohexylphosphine)-2-(2'-aminobiphenyl)]palladium(II) Usage And Synthesis |
| Uses | PCy3 Pd G2 is a monophosphine-coordinated 2-phenylaniline-based palladacycle complex that can be used as a precatalyst:
- To prepare diarylmethanes by Suzuki cross-coupling reaction with heterocyclic-chloromethyl derivatives with aryl/heteroaryl boronic acids.
- To synthesize poly(arylene)s by the Suzuki cross-coupling polymerization reaction between aryl dihalides and aryldiboronic acids.
- In the C-H bond functionalization reactions.
| | reaction suitability | core: palladium
reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: C-H Activation
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: catalyst
reaction type: Cross Couplings |
| | Chloro[(tricyclohexylphosphine)-2-(2'-aminobiphenyl)]palladium(II) Preparation Products And Raw materials |
|