| Company Name: |
Shandong Jiecheng Pharmaceutical Co., Ltd Gold
|
| Tel: |
0531-83130525 15901090278 |
| Email: |
bjmarui@126.com |
| Products Intro: |
Product Name:Acetylgastrodin
CAS:59252-47-0
Purity:企業(yè)標(biāo)準(zhǔn) Package:25KG;1KG；1tons
|
|
| | acetylgastrodin Basic information |
| Product Name: | acetylgastrodin | | Synonyms: | acetylgastrodin;β-D-Glucopyranoside, 4-[(acetyloxy)methyl]phenyl, 2,3,4,6-tetraacetate | | CAS: | 59252-47-0 | | MF: | C23H28O12 | | MW: | 496.46 | | EINECS: | | | Product Categories: | | | Mol File: | 59252-47-0.mol |  |
| | acetylgastrodin Chemical Properties |
| InChIKey | ZFAXRAALWQSKDW-PIHJKUTONA-N | | SMILES | C(OCC1=CC=C([C@]2(OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](CO)O2)C=C1)(=O)C |&1:7,12,17,22,27,r| |
| | acetylgastrodin Usage And Synthesis |
| | acetylgastrodin Preparation Products And Raw materials |
|