Hexafluoropropylene dimer manufacturers
|
| | Hexafluoropropylene dimer Basic information |
| Product Name: | Hexafluoropropylene dimer | | Synonyms: | HEXAFLUOROPROPENE;DIMERS OF HEXAFLUOROPROPENE;1,1,2,3,3,3-hexafluoroprop-1-ene;Dimer Hexafluoropropylene oxide;HEXAFLUOROPROPYLENE DIMER;1,1,2,3,3,3-Hexafluoro-1-propene, dimer;1-Propene, 1,1,2,3,3,3-hexafluoro-, dimer | | CAS: | 13429-24-8 | | MF: | C6F12 | | MW: | 300.05 | | EINECS: | | | Product Categories: | | | Mol File: | 13429-24-8.mol |  |
| | Hexafluoropropylene dimer Chemical Properties |
| Boiling point | 53-61°C | | density | 1.622 | | Fp | 10°F | | InChI | InChI=1S/C6F12/c7-2(3(8,9)6(16,17)18)1(4(10,11)12)5(13,14)15 | | InChIKey | FAEGGADNHFKDQX-UHFFFAOYSA-N | | SMILES | C(/C(F)(F)F)(\C(F)(F)F)=C(\F)/C(F)(F)C(F)(F)F | | EPA Substance Registry System | 1-Propene, 1,1,2,3,3,3-hexafluoro-, dimer (13429-24-8) |
| Hazard Codes | F | | Risk Statements | 11 | | Safety Statements | 16-29-33 | | RIDADR | UN 1993 | | Hazard Note | Irritant |
| | Hexafluoropropylene dimer Usage And Synthesis |
| Uses | Hexafluoropropene Dimer is used in the production of waterproof and oilproof Si/F-modified polyurethane finishing agent for textile and leather. Hexafluoropropene Dimer is also used as a blowing agent for manufacture of polyurethane foams. |
| | Hexafluoropropylene dimer Preparation Products And Raw materials |
|