|
|
| | epi-Doxycycline Basic information |
| Product Name: | epi-Doxycycline | | Synonyms: | (4S,4aR,5S,5aR,6S,12aS)-4-(Dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,5,10,12,12a-pentahydroxy-6-methyl-1,11-dioxo-2-naphthacenecarboxamide;6-Deoxy-6-epioxytetracycline;6-Epi Doxycycline;6-epi-Doxycycline;epi-Doxycycline;6-Epi Doxycycline, 65% (Contains Unknown Salts);Doxycycline Related Compound A (10 mg) (6-epidoxycycline);Doxycycline Related CoMpound A | | CAS: | 3219-99-6 | | MF: | C22H24N2O8 | | MW: | 444.43 | | EINECS: | | | Product Categories: | Chiral Reagents;Intermediates & Fine Chemicals;Pharmaceuticals;Chiral Reagents, Pharmaceuticals, Intermediates & Fine Chemicals | | Mol File: | 3219-99-6.mol |  |
| | epi-Doxycycline Chemical Properties |
| Melting point | >200°C (dec.) | | Boiling point | 762.6±60.0 °C(Predicted) | | density | 1.63±0.1 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under Inert Atmosphere | | solubility | Methanol (Slightly) | | form | Solid | | pka | 4.50±1.00(Predicted) | | color | Yellow to Dark Orange | | Stability: | Hygroscopic, Light Sensitive, Temperature Sensitive | | InChIKey | JBIWCJUYHHGXTC-IPJAVASBSA-N | | SMILES | C1(=O)[C@]2(O)[C@@]([H])([C@@H](O)[C@@]3([H])C(=C2O)C(=O)C2=C(C=CC=C2O)[C@H]3C)[C@H](N(C)C)C(O)=C1C(N)=O |
| | epi-Doxycycline Usage And Synthesis |
| Chemical Properties | Dark Yellow Solid | | Uses | One of the Doxycycline decomposition products. |
| | epi-Doxycycline Preparation Products And Raw materials |
|