| Company Name: |
Alta Scientific Co., Ltd. Gold
|
| Tel: |
022-6537-8550 15522853686 |
| Email: |
sales@altasci.com.cn |
| Products Intro: |
Product Name:Sodium cyclamate-d4
CAS:1627119-76-9
Purity:99% Package:10mg;100mg;1g
|
| Company Name: |
ShangHai YuanYe Biotechnology Co., Ltd.
|
| Tel: |
021-61312847 13636370518 |
| Email: |
shyysw007@163.com |
| Products Intro: |
Product Name:sodium cyclamate-d4
CAS:1627119-76-9
Purity:CP：98%，atom：98% Package:1mg Remarks:B28967
|
| Company Name: |
Artis Biotech Co. Ltd.
|
| Tel: |
19138486554 18582380095 |
| Email: |
sales@artisbio.com |
| Products Intro: |
Product Name:Sodium cyclamate-D4
CAS:1627119-76-9
Purity:99% HPLC Package:1mg 5mg 10mg 50mg 100mg
|
| Company Name: |
Shanghai YuanYe Biotechnology Co., Ltd.
|
| Tel: |
021-61312847; 18021002903 |
| Email: |
3008007409@qq.com |
| Products Intro: |
Product Name:sodium cyclamate-d4
CAS:1627119-76-9
Purity:100μg/mL in water Package:1.2ml Remarks:B28830
|
sodium cyclamate-d4 manufacturers
|
| | sodium cyclamate-d4 Basic information |
| Product Name: | sodium cyclamate-d4 | | Synonyms: | sodium cyclamate-d4;Cyclohexylaminosulfonic acid-d4;N-Cyclohexylsulfamic acid(D-4);2H4]-Sodium cyclamate;Sodium cyclamate-D4 in Water | | CAS: | 1627119-76-9 | | MF: | C6H8D4NNaO3S | | MW: | 205.243797112 | | EINECS: | | | Product Categories: | | | Mol File: | 1627119-76-9.mol |  |
| | sodium cyclamate-d4 Chemical Properties |
| InChI | InChI=1S/C6H13NO3S.Na/c8-11(9,10)7-6-4-2-1-3-5-6;/h6-7H,1-5H2,(H,8,9,10);/q;+1/p-1/i4D2,6D;/hD | | InChIKey | UDIPTWFVPPPURJ-NDDRUMIPSA-M | | SMILES | [Na+].S([O-])(N([2H])C1([2H])CCCCC1([2H])[2H])(=O)=O |
| | sodium cyclamate-d4 Usage And Synthesis |
| Uses | Cyclamic acid-d4 (sodium) is the deuterium labeled Cyclamic acid (sodium)[1]. | | References | [1] Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019 Feb;53(2):211-216. DOI:10.1177/1060028018797110 |
| | sodium cyclamate-d4 Preparation Products And Raw materials |
|