- Nitroethylene
-
- $10.00 / 2KG
-
2019-07-06
- CAS:3638-64-0
- Min. Order: 1UG
- Purity: 99%
- Supply Ability: Customer customization
- Nitroethylene
-
- $20.00 / 1KG
-
2019-07-06
- CAS:3638-64-0
- Min. Order: 25KG
- Purity: 99%
- Supply Ability: 20kg
|
| | Nitroethylene Basic information |
| Product Name: | Nitroethylene | | Synonyms: | NITROETHYLENE;1-Nitroethene;NITROBENZENDICARBOXYLATE,DIMETHYL;nitroethene (2.0M in toluene);1-nitroethylene;Nitroethylene(Nitroethene);1-Nitroethene (~ 1 mole/L in Toluene);Ethene, nitro- (9CI) | | CAS: | 3638-64-0 | | MF: | C2H3NO2 | | MW: | 73.05 | | EINECS: | | | Product Categories: | | | Mol File: | 3638-64-0.mol |  |
| | Nitroethylene Chemical Properties |
| Melting point | -55.5°C | | Boiling point | 98.55°C | | density | 1.2212 | | refractive index | 1.4282 | | solubility | soluble in Chloroform, Methanol, Toluene | | form | Colourless to Light Yellow Solution | | InChI | InChI=1S/C2H3NO2/c1-2-3(4)5/h2H,1H2 | | InChIKey | RPMXALUWKZHYOV-UHFFFAOYSA-N | | SMILES | C=C[N+]([O-])=O | | CAS DataBase Reference | 3638-64-0 | | NIST Chemistry Reference | Nitroethylene(3638-64-0) | | EPA Substance Registry System | Ethene, nitro- (3638-64-0) |
| | Nitroethylene Usage And Synthesis |
| Chemical Properties | Colourless Solution | | Uses | Nitroethylene is the simplest ntiroalkene and serves as a useful intermediate for the production of various chemicals and pharmaceutical goods. | | Definition | ChEBI: A nitroalkene having ethenyl as the alkene portion. | | Synthesis |
Nitroethylene is best prepared by dehydration of 2-nitroethanol using phthalic anhydride (eq 1). It can also be generated for reactions in situ from several precursors, especially 2-nitroethyl phenyl sulfoxide.
| | Precautions | Lachrymatory oil. It polymerizes readily in the presence of water and violently with the base. The purified compound darkens quickly, but 10% solutions in dry benzene can be kept for 6 months or longer when refrigerated. |
| | Nitroethylene Preparation Products And Raw materials |
|