|
| Methyl toluenesulfonate Basic information |
Product Name: | Methyl toluenesulfonate | Synonyms: | Methylbenzenesulfonic acid methyl ester;methyl toluenesulfonate;toluenesulfonic acid methyl ester;methyl toluenesulphonate;mixtureof;P / O-TOLUENE SULFONIC ACID METHYL ESTER;2/4-Toluenesulfonic acid methyl ester;Benzenesulfonic acid, methyl-, methyl ester | CAS: | 28804-47-9 | MF: | C8H10O3S | MW: | 186.23 | EINECS: | 249-237-3 | Product Categories: | | Mol File: | 28804-47-9.mol |  |
| Methyl toluenesulfonate Chemical Properties |
InChI | InChI=1S/C8H10O3S/c1-7-3-5-8(6-4-7)12(9,10)11-2/h3-6H,1-2H3 | InChIKey | VUQUOGPMUUJORT-UHFFFAOYSA-N | SMILES | S(=O)(=O)(OC)C1C=CC(C)=CC=1 |
| Methyl toluenesulfonate Usage And Synthesis |
| Methyl toluenesulfonate Preparation Products And Raw materials |
|