|
|
| | DL-alpha-Methoxyphenylacetic acid Basic information |
| Product Name: | DL-alpha-Methoxyphenylacetic acid | | Synonyms: | Benzeneacetic acid, alpha-methoxy-, (.+/-.)-;(+-)-A-METHOXYPHENYLACETIC ACID;(±)-α-Methoxyphenylacetic acid, O-Methyl-DL-mandelic acid;rac-(R*)-Methoxyphenylacetic acid;rac-(αR*)-α-Methoxybenzeneacetic acid;DL-alpha-Methoxyphenylacetic acid,99%;α-Methoxyphenylacetic acid,(±)-α-Methoxyphenylacetic acid, O-Methyl-DL-mandelic acid;DL-alpha-Methoxyphenylacetic acid, 99% 1GR | | CAS: | 7021-09-2 | | MF: | C9H10O3 | | MW: | 166.17 | | EINECS: | 230-300-9 | | Product Categories: | Aromatic Phenylacetic Acids and Derivatives | | Mol File: | 7021-09-2.mol |  |
| | DL-alpha-Methoxyphenylacetic acid Chemical Properties |
| Melting point | 69-71 °C(lit.) | | Boiling point | 165 °C18 mm Hg(lit.) | | density | 1.1708 (rough estimate) | | refractive index | 1.5500 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Ethanol,Chloroform,Acetone,Methanol,Ether | | form | crystalline | | pka | 3.10±0.10(Predicted) | | color | white | | BRN | 2209197 | | InChI | InChI=1S/C9H10O3/c1-12-8(9(10)11)7-5-3-2-4-6-7/h2-6,8H,1H3,(H,10,11) | | InChIKey | DIWVBIXQCNRCFE-UHFFFAOYSA-N | | SMILES | C1(C=CC=CC=1)C(OC)C(=O)O | | CAS DataBase Reference | 7021-09-2(CAS DataBase Reference) | | NIST Chemistry Reference | Acetic acid, methoxyphenyl(7021-09-2) | | EPA Substance Registry System | .alpha.-Methoxyphenylacetic acid (7021-09-2) |
| | DL-alpha-Methoxyphenylacetic acid Usage And Synthesis |
| Chemical Properties | off-white to light beige crystalline powder | | Uses | α-Methoxyphenylacetic acid has been used in the enantioresolution of two diastereomeric esters by HPLC. | | Uses | DL-alpha-Methoxyphenylacetic acid has been used in the enantioresolution of two diastereomeric esters by HPLC. | | Definition | ChEBI: DL-alpha-Methoxyphenylacetic acid is a benzyl ether. | | Synthesis Reference(s) | Journal of the American Chemical Society, 82, p. 4062, 1960 DOI: 10.1021/ja01500a061 | | General Description | Enantiomers of α-methoxyphenylacetic acid has been resolved as amide derivatives on chiral statinary phases by HPLC. α-Methoxyphenylacetic acid is also known as Trost′s chiral acid. |
| | DL-alpha-Methoxyphenylacetic acid Preparation Products And Raw materials |
|