- DIPHENYLFULVENE
-
- $15.00 / 1KG
-
2021-08-12
- CAS:2175-90-8
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
- 6,6-Diphenylfulvene
-
- $15.00 / 1KG
-
2021-07-02
- CAS:2175-90-8
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
- DIPHENYLFULVENE
-
- $1.00 / 1KG
-
2020-01-13
- CAS:2175-90-8
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100KG
|
| Product Name: | DIPHENYLFULVENE | | Synonyms: | DIPHENYLFULVENE;6,6-DIPHENYLFULVENE;5-(DIPHENYLMETHYLENE)-1,3-CYCLOPENTADIENE;[2,4-Cyclopentadien-1-ylidene(phenyl)methyl]benzene;Diphenylmethylidene cyclopentadiene;Fulvene, 6,6-diphenyl;Methane, 2,4-cyclopentadien-1-ylidenediphenyl-;1,1'-[(2,4-Cyclopentadienylidene)methylene]bisbenzene | | CAS: | 2175-90-8 | | MF: | C18H14 | | MW: | 230.3 | | EINECS: | 218-533-4 | | Product Categories: | Alkenes;Organic Building Blocks;Miscellaneous;Acyclic | | Mol File: | 2175-90-8.mol |  |
| | DIPHENYLFULVENE Chemical Properties |
| Melting point | 81.5-83 °C (lit.) | | Boiling point | 307.3°C (rough estimate) | | density | 1.0829 (estimate) | | vapor pressure | 0.033-0.084Pa at 25℃ | | refractive index | 1.5500 (estimate) | | storage temp. | Refrigerator | | form | Solid | | color | Light yellow to Brown | | InChI | InChI=1S/C18H14/c1-3-9-15(10-4-1)18(17-13-7-8-14-17)16-11-5-2-6-12-16/h1-14H | | InChIKey | BULLHRADHZGONG-UHFFFAOYSA-N | | SMILES | C(/C1=CC=CC=C1)(\C1=CC=CC=C1)=C1\C=CC=C\1 | | LogP | 3.43 | | CAS DataBase Reference | 2175-90-8(CAS DataBase Reference) | | EPA Substance Registry System | Benzene, 1,1'-(2,4-cyclopentadien-1-ylidenemethylene)bis- (2175-90-8) |
| WGK Germany | 3 | | HS Code | 2902.90.9000 |
| | DIPHENYLFULVENE Usage And Synthesis |
| | DIPHENYLFULVENE Preparation Products And Raw materials |
|