| Identification | Back Directory | [Name]
Praeruptorin B | [CAS]
81740-07-0 | [Synonyms]
anomalin
Paeruptorin B
Praeruptorin B
(+)Pareruptorin B
Praeruptorin B 81740-07-0
Praeruptorin B, 98%, from Peucedanum praeruptorum Dunn
[8,8-dimethyl-9-[(E)-2-methylbut-2-enoyl]oxy-2-oxo-9,10-dihydropyrano[2,3-f]chromen-10-yl] (E)-2-methylbut-2-enoate
[8,8-Dimethyl-9-[(E)-2-methylbut-2-enoyl]oxy-2-oxo-9,10-dihydropyrano[6,5-h]chromen-10-yl] (E)-2-methylbut-2-enoate | [Molecular Formula]
C24H26O7 | [MDL Number]
MFCD09839133 | [MOL File]
81740-07-0.mol | [Molecular Weight]
426.46 |
| Chemical Properties | Back Directory | [Melting point ]
179-181°C | [storage temp. ]
Amber Vial, -20°C Freezer, Under inert atmosphere | [solubility ]
Chloroform (Slightly), Methanol (Slightly, Heated) | [form ]
Solid | [color ]
Off-White | [Stability:]
Light Sensitive | [InChI]
InChI=1S/C24H26O7/c1-7-13(3)22(26)29-20-18-16(11-9-15-10-12-17(25)28-19(15)18)31-24(5,6)21(20)30-23(27)14(4)8-2/h7-12,20-21H,1-6H3/b13-7+,14-8+ | [InChIKey]
PNTWXEIQXBRCPS-FNCQTZNRSA-N | [SMILES]
C(OC1C2C3OC(=O)C=CC=3C=CC=2OC(C)(C)C1OC(=O)/C(/C)=C/C)(=O)/C(/C)=C/C |
| Hazard Information | Back Directory | [Uses]
Praeruptorin B is a bioactive constituent of Peucedani Radix, a traditional Chinese medicinal herb used in the treatment of respiratory and pulmonary disorders. |
|
|